C16H9Cl4N3OS3 — CID 4045098
2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 4045098) has the molecular formula C16H9Cl4N3OS3 and a molecular weight of 497.28 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 4045098 |
| Molecular Formula | C16H9Cl4N3OS3 |
| Molecular Weight | 497.28 g/mol |
| Exact Mass | 494.87 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CSc1nn(-c2ccc(Cl)cc2)c(=S)s1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H9Cl4N3OS3/c17-8-1-3-9(4-2-8)23-16(25)27-15(22-23)26-7-14(24)21-13-6-11(19)10(18)5-12(13)20/h1-6H,7H2,(H,21,24) |
| InChIKey | ISHXSIYWUUGANO-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.28 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|