C18H16ClN3O3S3 — CID 3948238
2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 3948238) has the molecular formula C18H16ClN3O3S3 and a molecular weight of 454.00 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3948238 |
| Molecular Formula | C18H16ClN3O3S3 |
| Molecular Weight | 454.00 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nn(-c3ccc(Cl)cc3)c(=S)s2)cc1OC |
| InChI | InChI=1S/C18H16ClN3O3S3/c1-24-14-8-5-12(9-15(14)25-2)20-16(23)10-27-17-21-22(18(26)28-17)13-6-3-11(19)4-7-13/h3-9H,10H2,1-2H3,(H,20,23) |
| InChIKey | IZFOICSTWKTUML-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.00 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|