C18H15Cl2N3OS3 — CID 3920121
2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-ethylphenyl)acetamide (PubChem CID 3920121) has the molecular formula C18H15Cl2N3OS3 and a molecular weight of 456.45 g/mol. Its IUPAC name is 2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 3920121 |
| Molecular Formula | C18H15Cl2N3OS3 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 454.98 |
| IUPAC Name | 2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)CSc2nn(-c3ccc(Cl)c(Cl)c3)c(=S)s2)cc1 |
| InChI | InChI=1S/C18H15Cl2N3OS3/c1-2-11-3-5-12(6-4-11)21-16(24)10-26-17-22-23(18(25)27-17)13-7-8-14(19)15(20)9-13/h3-9H,2,10H2,1H3,(H,21,24) |
| InChIKey | LJGAXFFLJADXDG-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|