C14H15Cl2N3OS3 — CID 3473982
N-butan-2-yl-2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 3473982) has the molecular formula C14H15Cl2N3OS3 and a molecular weight of 408.40 g/mol. Its IUPAC name is N-butan-2-yl-2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-butan-2-yl-2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3473982 |
| Molecular Formula | C14H15Cl2N3OS3 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | N-butan-2-yl-2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CCC(C)NC(=O)CSc1nn(-c2ccc(Cl)c(Cl)c2)c(=S)s1 |
| InChI | InChI=1S/C14H15Cl2N3OS3/c1-3-8(2)17-12(20)7-22-13-18-19(14(21)23-13)9-4-5-10(15)11(16)6-9/h4-6,8H,3,7H2,1-2H3,(H,17,20) |
| InChIKey | DZRZBTRELCQSQK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|