C20H21N3OS3 — CID 7994176
N-[(1R)-1-(4-ethylphenyl)ethyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 7994176) has the molecular formula C20H21N3OS3 and a molecular weight of 415.61 g/mol. Its IUPAC name is N-[(1R)-1-(4-ethylphenyl)ethyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(1R)-1-(4-ethylphenyl)ethyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 7994176 |
| Molecular Formula | C20H21N3OS3 |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-[(1R)-1-(4-ethylphenyl)ethyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | CCc1ccc([C@@H](C)NC(=O)CSc2nn(-c3ccccc3)c(=S)s2)cc1 |
| InChI | InChI=1S/C20H21N3OS3/c1-3-15-9-11-16(12-10-15)14(2)21-18(24)13-26-19-22-23(20(25)27-19)17-7-5-4-6-8-17/h4-12,14H,3,13H2,1-2H3,(H,21,24)/t14-/m1/s1 |
| InChIKey | RCHFODVFZGFCJO-CQSZACIVSA-N |
| XLogP | 5.20 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|