C20H19Cl2N3OS3 — CID 3483851
2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-phenylbutan-2-yl)acetamide (PubChem CID 3483851) has the molecular formula C20H19Cl2N3OS3 and a molecular weight of 484.50 g/mol. Its IUPAC name is 2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-phenylbutan-2-yl)acetamide.
| Compound Name | 2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-phenylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 3483851 |
| Molecular Formula | C20H19Cl2N3OS3 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | 2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-phenylbutan-2-yl)acetamide |
| SMILES | CC(CCc1ccccc1)NC(=O)CSc1nn(-c2ccc(Cl)c(Cl)c2)c(=S)s1 |
| InChI | InChI=1S/C20H19Cl2N3OS3/c1-13(7-8-14-5-3-2-4-6-14)23-18(26)12-28-19-24-25(20(27)29-19)15-9-10-16(21)17(22)11-15/h2-6,9-11,13H,7-8,12H2,1H3,(H,23,26) |
| InChIKey | UCVCKODOJWDPKF-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|