C17H13Cl2N3OS3 — CID 5020707
N-benzyl-2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 5020707) has the molecular formula C17H13Cl2N3OS3 and a molecular weight of 442.42 g/mol. Its IUPAC name is N-benzyl-2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-benzyl-2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 5020707 |
| Molecular Formula | C17H13Cl2N3OS3 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 440.96 |
| IUPAC Name | N-benzyl-2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nn(-c2ccc(Cl)c(Cl)c2)c(=S)s1)NCc1ccccc1 |
| InChI | InChI=1S/C17H13Cl2N3OS3/c18-13-7-6-12(8-14(13)19)22-17(24)26-16(21-22)25-10-15(23)20-9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,20,23) |
| InChIKey | UEZFNKIUAKHWAA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|