C18H17N3OS3 — CID 7405546
N-[(4-methylphenyl)methyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 7405546) has the molecular formula C18H17N3OS3 and a molecular weight of 387.56 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(4-methylphenyl)methyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 7405546 |
| Molecular Formula | C18H17N3OS3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)CSc2nn(-c3ccccc3)c(=S)s2)cc1 |
| InChI | InChI=1S/C18H17N3OS3/c1-13-7-9-14(10-8-13)11-19-16(22)12-24-17-20-21(18(23)25-17)15-5-3-2-4-6-15/h2-10H,11-12H2,1H3,(H,19,22) |
| InChIKey | BWZCKUWXKZGVTD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|