C14H14N4O2S3 — CID 7420003
2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide (PubChem CID 7420003) has the molecular formula C14H14N4O2S3 and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide.
| Compound Name | 2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 7420003 |
| Molecular Formula | C14H14N4O2S3 |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide |
| SMILES | C=CCNC(=O)NC(=O)CSc1nn(-c2ccccc2)c(=S)s1 |
| InChI | InChI=1S/C14H14N4O2S3/c1-2-8-15-12(20)16-11(19)9-22-13-17-18(14(21)23-13)10-6-4-3-5-7-10/h2-7H,1,8-9H2,(H2,15,16,19,20) |
| InChIKey | CSRBXWLBJQWCAA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|