C14H11N5OS3 — CID 2437951
2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]-N-pyrimidin-2-ylacetamide (PubChem CID 2437951) has the molecular formula C14H11N5OS3 and a molecular weight of 361.48 g/mol. Its IUPAC name is 2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]-N-pyrimidin-2-ylacetamide.
| Compound Name | 2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]-N-pyrimidin-2-ylacetamide |
|---|---|
| PubChem CID | 2437951 |
| Molecular Formula | C14H11N5OS3 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]-N-pyrimidin-2-ylacetamide |
| SMILES | O=C(CSc1nn(-c2ccccc2)c(=S)s1)Nc1ncccn1 |
| InChI | InChI=1S/C14H11N5OS3/c20-11(17-12-15-7-4-8-16-12)9-22-13-18-19(14(21)23-13)10-5-2-1-3-6-10/h1-8H,9H2,(H,15,16,17,20) |
| InChIKey | WDJFVXRMFCXSPY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|