C16H14N2S3 — CID 7994248
5-[(4-methylphenyl)methylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione (PubChem CID 7994248) has the molecular formula C16H14N2S3 and a molecular weight of 330.50 g/mol. Its IUPAC name is 5-[(4-methylphenyl)methylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[(4-methylphenyl)methylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 7994248 |
| Molecular Formula | C16H14N2S3 |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 5-[(4-methylphenyl)methylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1ccc(CSc2nn(-c3ccccc3)c(=S)s2)cc1 |
| InChI | InChI=1S/C16H14N2S3/c1-12-7-9-13(10-8-12)11-20-15-17-18(16(19)21-15)14-5-3-2-4-6-14/h2-10H,11H2,1H3 |
| InChIKey | JANJJGOBJDFJRJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|