C13H14N6S3 — CID 78812891
3-phenyl-5-[(1-propyltetrazol-5-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione (PubChem CID 78812891) has the molecular formula C13H14N6S3 and a molecular weight of 350.50 g/mol. Its IUPAC name is 3-phenyl-5-[(1-propyltetrazol-5-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-phenyl-5-[(1-propyltetrazol-5-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 78812891 |
| Molecular Formula | C13H14N6S3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 3-phenyl-5-[(1-propyltetrazol-5-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione |
| SMILES | CCCn1nnnc1CSc1nn(-c2ccccc2)c(=S)s1 |
| InChI | InChI=1S/C13H14N6S3/c1-2-8-18-11(14-16-17-18)9-21-12-15-19(13(20)22-12)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | IKTXOHOOCDMWGH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|