C11H14N4OS — CID 60864055
4-[(1-propyltetrazol-5-yl)methylsulfanyl]phenol (PubChem CID 60864055) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 4-[(1-propyltetrazol-5-yl)methylsulfanyl]phenol.
| Compound Name | 4-[(1-propyltetrazol-5-yl)methylsulfanyl]phenol |
|---|---|
| PubChem CID | 60864055 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4-[(1-propyltetrazol-5-yl)methylsulfanyl]phenol |
| SMILES | CCCn1nnnc1CSc1ccc(O)cc1 |
| InChI | InChI=1S/C11H14N4OS/c1-2-7-15-11(12-13-14-15)8-17-10-5-3-9(16)4-6-10/h3-6,16H,2,7-8H2,1H3 |
| InChIKey | UYLXSWBDGXQYLN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |