C16H22N8S — CID 78812765
1-(4-butylphenyl)-5-[(1-propyltetrazol-5-yl)methylsulfanyl]tetrazole (PubChem CID 78812765) has the molecular formula C16H22N8S and a molecular weight of 358.48 g/mol. Its IUPAC name is 1-(4-butylphenyl)-5-[(1-propyltetrazol-5-yl)methylsulfanyl]tetrazole.
| Compound Name | 1-(4-butylphenyl)-5-[(1-propyltetrazol-5-yl)methylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 78812765 |
| Molecular Formula | C16H22N8S |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-(4-butylphenyl)-5-[(1-propyltetrazol-5-yl)methylsulfanyl]tetrazole |
| SMILES | CCCCc1ccc(-n2nnnc2SCc2nnnn2CCC)cc1 |
| InChI | InChI=1S/C16H22N8S/c1-3-5-6-13-7-9-14(10-8-13)24-16(18-20-22-24)25-12-15-17-19-21-23(15)11-4-2/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | DKHMTOICQXLZEP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |