About 1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole
1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole (PubChem CID 47009469) has the molecular formula C9H15N7S
and a molecular weight of 253.33 g/mol. Its IUPAC name is 1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole.
Molecular Properties
| Compound Name | 1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole |
| PubChem CID | 47009469 |
| Molecular Formula | C9H15N7S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole |
| SMILES | CCCCn1nnnc1CSc1nncn1C |
| InChI | InChI=1S/C9H15N7S/c1-3-4-5-16-8(11-13-14-16)6-17-9-12-10-7-15(9)2/h7H,3-6H2,1-2H3 |
| InChIKey | LNEXMXJJGYSFCB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole?
The IUPAC name of 1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole (CID 47009469) is 1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole.
What is the SMILES notation for 1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole?
The canonical SMILES for 1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole is CCCCn1nnnc1CSc1nncn1C.
What is the InChIKey of 1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole?
The InChIKey is LNEXMXJJGYSFCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N7S/c1-3-4-5-16-8(11-13-14-16)6-17-9-12-10-7-15(9)2/h7H,3-6H2,1-2H3.
What are the key properties of 1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole?
1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole has a molecular weight of 253.33 g/mol, XLogP of 0.89, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]tetrazole is sourced from PubChem (CID 47009469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).