C19H27N5O2S — CID 51306550
2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-4-oxopentan-3-yl)acetamide (PubChem CID 51306550) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is 2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-4-oxopentan-3-yl)acetamide.
| Compound Name | 2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-4-oxopentan-3-yl)acetamide |
|---|---|
| PubChem CID | 51306550 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-4-oxopentan-3-yl)acetamide |
| SMILES | CCCCc1ccc(-n2nnnc2SCC(=O)NC(C(C)=O)C(C)C)cc1 |
| InChI | InChI=1S/C19H27N5O2S/c1-5-6-7-15-8-10-16(11-9-15)24-19(21-22-23-24)27-12-17(26)20-18(13(2)3)14(4)25/h8-11,13,18H,5-7,12H2,1-4H3,(H,20,26) |
| InChIKey | ILNQOANAODCICO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |