C18H20N6O3S — CID 9360183
N'-[2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanylacetyl]furan-2-carbohydrazide (PubChem CID 9360183) has the molecular formula C18H20N6O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is N'-[2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanylacetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanylacetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 9360183 |
| Molecular Formula | C18H20N6O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N'-[2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanylacetyl]furan-2-carbohydrazide |
| SMILES | CCCCc1ccc(-n2nnnc2SCC(=O)NNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C18H20N6O3S/c1-2-3-5-13-7-9-14(10-8-13)24-18(21-22-23-24)28-12-16(25)19-20-17(26)15-6-4-11-27-15/h4,6-11H,2-3,5,12H2,1H3,(H,19,25)(H,20,26) |
| InChIKey | GHVPNJUFFGQVKX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|