C15H14N6O3S — CID 7646637
N'-[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]furan-2-carbohydrazide (PubChem CID 7646637) has the molecular formula C15H14N6O3S and a molecular weight of 358.38 g/mol. Its IUPAC name is N'-[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 7646637 |
| Molecular Formula | C15H14N6O3S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | N'-[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]furan-2-carbohydrazide |
| SMILES | Cc1ccccc1-n1nnnc1SCC(=O)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C15H14N6O3S/c1-10-5-2-3-6-11(10)21-15(18-19-20-21)25-9-13(22)16-17-14(23)12-7-4-8-24-12/h2-8H,9H2,1H3,(H,16,22)(H,17,23) |
| InChIKey | UUUMGUAXLOXGEE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|