C25H23BrN6O4S — CID 4854392
3-bromo-5-methoxy-N'-[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]-4-phenylmethoxybenzohydrazide (PubChem CID 4854392) has the molecular formula C25H23BrN6O4S and a molecular weight of 583.47 g/mol. Its IUPAC name is 3-bromo-5-methoxy-N'-[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]-4-phenylmethoxybenzohydrazide.
| Compound Name | 3-bromo-5-methoxy-N'-[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]-4-phenylmethoxybenzohydrazide |
|---|---|
| PubChem CID | 4854392 |
| Molecular Formula | C25H23BrN6O4S |
| Molecular Weight | 583.47 g/mol |
| Exact Mass | 582.07 |
| IUPAC Name | 3-bromo-5-methoxy-N'-[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]-4-phenylmethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)CSc2nnnn2-c2ccccc2C)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H23BrN6O4S/c1-16-8-6-7-11-20(16)32-25(29-30-31-32)37-15-22(33)27-28-24(34)18-12-19(26)23(21(13-18)35-2)36-14-17-9-4-3-5-10-17/h3-13H,14-15H2,1-2H3,(H,27,33)(H,28,34) |
| InChIKey | OPHCDZGOYSLOLE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|