C22H20N6OS — CID 3369531
2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N',N'-diphenylacetohydrazide (PubChem CID 3369531) has the molecular formula C22H20N6OS and a molecular weight of 416.51 g/mol. Its IUPAC name is 2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N',N'-diphenylacetohydrazide.
| Compound Name | 2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N',N'-diphenylacetohydrazide |
|---|---|
| PubChem CID | 3369531 |
| Molecular Formula | C22H20N6OS |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N',N'-diphenylacetohydrazide |
| SMILES | Cc1ccccc1-n1nnnc1SCC(=O)NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20N6OS/c1-17-10-8-9-15-20(17)28-22(23-25-26-28)30-16-21(29)24-27(18-11-4-2-5-12-18)19-13-6-3-7-14-19/h2-15H,16H2,1H3,(H,24,29) |
| InChIKey | ZSCAQLLSHSHJNK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|