C17H17N5OS — CID 2420493
N-benzyl-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 2420493) has the molecular formula C17H17N5OS and a molecular weight of 339.42 g/mol. Its IUPAC name is N-benzyl-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-benzyl-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2420493 |
| Molecular Formula | C17H17N5OS |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-benzyl-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | Cc1ccccc1-n1nnnc1SCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H17N5OS/c1-13-7-5-6-10-15(13)22-17(19-20-21-22)24-12-16(23)18-11-14-8-3-2-4-9-14/h2-10H,11-12H2,1H3,(H,18,23) |
| InChIKey | MIEZXHFLLYFSIX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |