C18H19N5OS — CID 7647417
2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N-[(1S)-1-phenylethyl]acetamide (PubChem CID 7647417) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is 2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N-[(1S)-1-phenylethyl]acetamide.
| Compound Name | 2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N-[(1S)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 7647417 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N-[(1S)-1-phenylethyl]acetamide |
| SMILES | Cc1ccccc1-n1nnnc1SCC(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H19N5OS/c1-13-8-6-7-11-16(13)23-18(20-21-22-23)25-12-17(24)19-14(2)15-9-4-3-5-10-15/h3-11,14H,12H2,1-2H3,(H,19,24)/t14-/m0/s1 |
| InChIKey | YTRQDPNXADNZIO-AWEZNQCLSA-N |
| XLogP | 2.94 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |