C16H17N5OS2 — CID 7646493
2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide (PubChem CID 7646493) has the molecular formula C16H17N5OS2 and a molecular weight of 359.48 g/mol. Its IUPAC name is 2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 7646493 |
| Molecular Formula | C16H17N5OS2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide |
| SMILES | Cc1ccccc1-n1nnnc1SCC(=O)N[C@H](C)c1cccs1 |
| InChI | InChI=1S/C16H17N5OS2/c1-11-6-3-4-7-13(11)21-16(18-19-20-21)24-10-15(22)17-12(2)14-8-5-9-23-14/h3-9,12H,10H2,1-2H3,(H,17,22)/t12-/m1/s1 |
| InChIKey | MUDSPRVAYKQYBO-GFCCVEGCSA-N |
| XLogP | 3.00 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |