C25H24N6O2S — CID 4880546
2-[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 4880546) has the molecular formula C25H24N6O2S and a molecular weight of 472.57 g/mol. Its IUPAC name is 2-[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 2-[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 4880546 |
| Molecular Formula | C25H24N6O2S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 2-[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | Cc1ccccc1-n1nnnc1SCC(=O)Nc1ccccc1C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C25H24N6O2S/c1-17-10-6-9-15-22(17)31-25(28-29-30-31)34-16-23(32)27-21-14-8-7-13-20(21)24(33)26-18(2)19-11-4-3-5-12-19/h3-15,18H,16H2,1-2H3,(H,26,33)(H,27,32) |
| InChIKey | LPGZUDBVQDHRIS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |