C18H17FN6O3S — CID 16536997
N'-[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]-4-fluorobenzohydrazide (PubChem CID 16536997) has the molecular formula C18H17FN6O3S and a molecular weight of 416.44 g/mol. Its IUPAC name is N'-[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 16536997 |
| Molecular Formula | C18H17FN6O3S |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N'-[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]-4-fluorobenzohydrazide |
| SMILES | CCOc1ccccc1-n1nnnc1SCC(=O)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN6O3S/c1-2-28-15-6-4-3-5-14(15)25-18(22-23-24-25)29-11-16(26)20-21-17(27)12-7-9-13(19)10-8-12/h3-10H,2,11H2,1H3,(H,20,26)(H,21,27) |
| InChIKey | IXLODAMBFATLQP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|