C16H14FN5O2S — CID 3587799
N-(4-fluorophenyl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 3587799) has the molecular formula C16H14FN5O2S and a molecular weight of 359.39 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(4-fluorophenyl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 3587799 |
| Molecular Formula | C16H14FN5O2S |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-(4-fluorophenyl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | COc1ccccc1-n1nnnc1SCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H14FN5O2S/c1-24-14-5-3-2-4-13(14)22-16(19-20-21-22)25-10-15(23)18-12-8-6-11(17)7-9-12/h2-9H,10H2,1H3,(H,18,23) |
| InChIKey | BDXXNPMPKNWIRG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |