C18H17N5O4S — CID 33093690
methyl 3-[[2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate (PubChem CID 33093690) has the molecular formula C18H17N5O4S and a molecular weight of 399.43 g/mol. Its IUPAC name is methyl 3-[[2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 33093690 |
| Molecular Formula | C18H17N5O4S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | methyl 3-[[2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CSc2nnnn2-c2ccccc2OC)c1 |
| InChI | InChI=1S/C18H17N5O4S/c1-26-15-9-4-3-8-14(15)23-18(20-21-22-23)28-11-16(24)19-13-7-5-6-12(10-13)17(25)27-2/h3-10H,11H2,1-2H3,(H,19,24) |
| InChIKey | USQGRANNQNIYSI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |