C17H14ClN5O3S — CID 1265628
methyl 4-[[2-[1-(2-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate (PubChem CID 1265628) has the molecular formula C17H14ClN5O3S and a molecular weight of 403.85 g/mol. Its IUPAC name is methyl 4-[[2-[1-(2-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[1-(2-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 1265628 |
| Molecular Formula | C17H14ClN5O3S |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | methyl 4-[[2-[1-(2-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CSc2nnnn2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H14ClN5O3S/c1-26-16(25)11-6-8-12(9-7-11)19-15(24)10-27-17-20-21-22-23(17)14-5-3-2-4-13(14)18/h2-9H,10H2,1H3,(H,19,24) |
| InChIKey | AIVKGKASLLNSDP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |