C17H14F3N5O2S — CID 16649456
N-(3-methoxyphenyl)-2-[1-[2-(trifluoromethyl)phenyl]tetrazol-5-yl]sulfanylacetamide (PubChem CID 16649456) has the molecular formula C17H14F3N5O2S and a molecular weight of 409.39 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-[1-[2-(trifluoromethyl)phenyl]tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(3-methoxyphenyl)-2-[1-[2-(trifluoromethyl)phenyl]tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 16649456 |
| Molecular Formula | C17H14F3N5O2S |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N-(3-methoxyphenyl)-2-[1-[2-(trifluoromethyl)phenyl]tetrazol-5-yl]sulfanylacetamide |
| SMILES | COc1cccc(NC(=O)CSc2nnnn2-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F3N5O2S/c1-27-12-6-4-5-11(9-12)21-15(26)10-28-16-22-23-24-25(16)14-8-3-2-7-13(14)17(18,19)20/h2-9H,10H2,1H3,(H,21,26) |
| InChIKey | NTAQKIZOJKYMKF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |