C17H23N5O4S — CID 16536992
ethyl 4-[[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]amino]butanoate (PubChem CID 16536992) has the molecular formula C17H23N5O4S and a molecular weight of 393.47 g/mol. Its IUPAC name is ethyl 4-[[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]amino]butanoate |
|---|---|
| PubChem CID | 16536992 |
| Molecular Formula | C17H23N5O4S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | ethyl 4-[[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CSc1nnnn1-c1ccccc1OCC |
| InChI | InChI=1S/C17H23N5O4S/c1-3-25-14-9-6-5-8-13(14)22-17(19-20-21-22)27-12-15(23)18-11-7-10-16(24)26-4-2/h5-6,8-9H,3-4,7,10-12H2,1-2H3,(H,18,23) |
| InChIKey | QADVDBFIQCAMNM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|