C14H17N5O4S — CID 2632750
ethyl N-[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]carbamate (PubChem CID 2632750) has the molecular formula C14H17N5O4S and a molecular weight of 351.39 g/mol. Its IUPAC name is ethyl N-[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]carbamate.
| Compound Name | ethyl N-[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]carbamate |
|---|---|
| PubChem CID | 2632750 |
| Molecular Formula | C14H17N5O4S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | ethyl N-[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CSc1nnnn1-c1ccccc1OCC |
| InChI | InChI=1S/C14H17N5O4S/c1-3-22-11-8-6-5-7-10(11)19-13(16-17-18-19)24-9-12(20)15-14(21)23-4-2/h5-8H,3-4,9H2,1-2H3,(H,15,20,21) |
| InChIKey | CTVONKZDEYNJRD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |