C16H16N6O3S2 — CID 5036823
2-[[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]amino]thiophene-3-carboxamide (PubChem CID 5036823) has the molecular formula C16H16N6O3S2 and a molecular weight of 404.48 g/mol. Its IUPAC name is 2-[[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 5036823 |
| Molecular Formula | C16H16N6O3S2 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-[[2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetyl]amino]thiophene-3-carboxamide |
| SMILES | CCOc1ccccc1-n1nnnc1SCC(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C16H16N6O3S2/c1-2-25-12-6-4-3-5-11(12)22-16(19-20-21-22)27-9-13(23)18-15-10(14(17)24)7-8-26-15/h3-8H,2,9H2,1H3,(H2,17,24)(H,18,23) |
| InChIKey | XGBFWSOOABYNCR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |