C19H18N6O2S2 — CID 27160013
N-[2-(cyanomethylsulfanyl)phenyl]-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 27160013) has the molecular formula C19H18N6O2S2 and a molecular weight of 426.53 g/mol. Its IUPAC name is N-[2-(cyanomethylsulfanyl)phenyl]-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 27160013 |
| Molecular Formula | C19H18N6O2S2 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CCOc1ccccc1-n1nnnc1SCC(=O)Nc1ccccc1SCC#N |
| InChI | InChI=1S/C19H18N6O2S2/c1-2-27-16-9-5-4-8-15(16)25-19(22-23-24-25)29-13-18(26)21-14-7-3-6-10-17(14)28-12-11-20/h3-10H,2,12-13H2,1H3,(H,21,26) |
| InChIKey | YDOSNVHNQZQZPD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |