C18H17FN6O3S — CID 16536987
2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-N-[(2-fluorophenyl)carbamoyl]acetamide (PubChem CID 16536987) has the molecular formula C18H17FN6O3S and a molecular weight of 416.44 g/mol. Its IUPAC name is 2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-N-[(2-fluorophenyl)carbamoyl]acetamide.
| Compound Name | 2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-N-[(2-fluorophenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 16536987 |
| Molecular Formula | C18H17FN6O3S |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-N-[(2-fluorophenyl)carbamoyl]acetamide |
| SMILES | CCOc1ccccc1-n1nnnc1SCC(=O)NC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C18H17FN6O3S/c1-2-28-15-10-6-5-9-14(15)25-18(22-23-24-25)29-11-16(26)21-17(27)20-13-8-4-3-7-12(13)19/h3-10H,2,11H2,1H3,(H2,20,21,26,27) |
| InChIKey | LXEPQDGJJYLQGU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |