C18H16FN5O3S — CID 1440796
ethyl 2-[[2-[1-(2-fluorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate (PubChem CID 1440796) has the molecular formula C18H16FN5O3S and a molecular weight of 401.42 g/mol. Its IUPAC name is ethyl 2-[[2-[1-(2-fluorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[1-(2-fluorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 1440796 |
| Molecular Formula | C18H16FN5O3S |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | ethyl 2-[[2-[1-(2-fluorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CSc1nnnn1-c1ccccc1F |
| InChI | InChI=1S/C18H16FN5O3S/c1-2-27-17(26)12-7-3-5-9-14(12)20-16(25)11-28-18-21-22-23-24(18)15-10-6-4-8-13(15)19/h3-10H,2,11H2,1H3,(H,20,25) |
| InChIKey | ZUSBFSOURYLXMQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |