C19H19N5O4S — CID 2609126
methyl 2-[[2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate (PubChem CID 2609126) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is methyl 2-[[2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 2609126 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | methyl 2-[[2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CSc1nnnn1-c1cc(C)ccc1OC |
| InChI | InChI=1S/C19H19N5O4S/c1-12-8-9-16(27-2)15(10-12)24-19(21-22-23-24)29-11-17(25)20-14-7-5-4-6-13(14)18(26)28-3/h4-10H,11H2,1-3H3,(H,20,25) |
| InChIKey | YKRARLUSUBDWHG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |