C19H19N5O3S — CID 2609128
N-(4-acetylphenyl)-2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 2609128) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(4-acetylphenyl)-2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2609128 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-(4-acetylphenyl)-2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C19H19N5O3S/c1-12-4-9-17(27-3)16(10-12)24-19(21-22-23-24)28-11-18(26)20-15-7-5-14(6-8-15)13(2)25/h4-10H,11H2,1-3H3,(H,20,26) |
| InChIKey | ZRLNMRLQFJNVIX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |