C16H15ClN6O2S — CID 2460477
N-(5-chloro-2-pyridinyl)-2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 2460477) has the molecular formula C16H15ClN6O2S and a molecular weight of 390.86 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2460477 |
| Molecular Formula | C16H15ClN6O2S |
| Molecular Weight | 390.86 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H15ClN6O2S/c1-10-3-5-13(25-2)12(7-10)23-16(20-21-22-23)26-9-15(24)19-14-6-4-11(17)8-18-14/h3-8H,9H2,1-2H3,(H,18,19,24) |
| InChIKey | LEWLRBVTYRISEF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.86 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |