C17H24N6O3S — CID 2608879
2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanyl-N-(3-methylbutylcarbamoyl)acetamide (PubChem CID 2608879) has the molecular formula C17H24N6O3S and a molecular weight of 392.49 g/mol. Its IUPAC name is 2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanyl-N-(3-methylbutylcarbamoyl)acetamide.
| Compound Name | 2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanyl-N-(3-methylbutylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 2608879 |
| Molecular Formula | C17H24N6O3S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanyl-N-(3-methylbutylcarbamoyl)acetamide |
| SMILES | COc1ccc(C)cc1-n1nnnc1SCC(=O)NC(=O)NCCC(C)C |
| InChI | InChI=1S/C17H24N6O3S/c1-11(2)7-8-18-16(25)19-15(24)10-27-17-20-21-22-23(17)13-9-12(3)5-6-14(13)26-4/h5-6,9,11H,7-8,10H2,1-4H3,(H2,18,19,24,25) |
| InChIKey | LCWSUNAZGYRSKM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |