C19H17FN4O4S — CID 7903908
[2-(4-fluorophenyl)-2-oxoethyl] 2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetate (PubChem CID 7903908) has the molecular formula C19H17FN4O4S and a molecular weight of 416.43 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetate |
|---|---|
| PubChem CID | 7903908 |
| Molecular Formula | C19H17FN4O4S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetate |
| SMILES | CCOc1ccccc1-n1nnnc1SCC(=O)OCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN4O4S/c1-2-27-17-6-4-3-5-15(17)24-19(21-22-23-24)29-12-18(26)28-11-16(25)13-7-9-14(20)10-8-13/h3-10H,2,11-12H2,1H3 |
| InChIKey | ZLVDYPLBQLMJTG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |