C22H20N6O3S — CID 43812949
N'-[2-[[4-(2,3-dimethylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide (PubChem CID 43812949) has the molecular formula C22H20N6O3S and a molecular weight of 448.51 g/mol. Its IUPAC name is N'-[2-[[4-(2,3-dimethylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[[4-(2,3-dimethylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 43812949 |
| Molecular Formula | C22H20N6O3S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | N'-[2-[[4-(2,3-dimethylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide |
| SMILES | Cc1cccc(-n2c(SCC(=O)NNC(=O)c3ccco3)nnc2-c2cccnc2)c1C |
| InChI | InChI=1S/C22H20N6O3S/c1-14-6-3-8-17(15(14)2)28-20(16-7-4-10-23-12-16)25-27-22(28)32-13-19(29)24-26-21(30)18-9-5-11-31-18/h3-12H,13H2,1-2H3,(H,24,29)(H,26,30) |
| InChIKey | PSAIYRUCRQQROA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|