C13H11N5O3S — CID 9373294
N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetyl]furan-2-carbohydrazide (PubChem CID 9373294) has the molecular formula C13H11N5O3S and a molecular weight of 317.33 g/mol. Its IUPAC name is N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 9373294 |
| Molecular Formula | C13H11N5O3S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetyl]furan-2-carbohydrazide |
| SMILES | O=C(CSc1nnc2ccccn12)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C13H11N5O3S/c19-11(15-16-12(20)9-4-3-7-21-9)8-22-13-17-14-10-5-1-2-6-18(10)13/h1-7H,8H2,(H,15,19)(H,16,20) |
| InChIKey | BDLBCMLZVPLSQM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|