C17H16ClN5O3S — CID 4790912
N'-[2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide (PubChem CID 4790912) has the molecular formula C17H16ClN5O3S and a molecular weight of 405.87 g/mol. Its IUPAC name is N'-[2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 4790912 |
| Molecular Formula | C17H16ClN5O3S |
| Molecular Weight | 405.87 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | N'-[2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide |
| SMILES | CCn1c(SCC(=O)NNC(=O)c2ccco2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClN5O3S/c1-2-23-15(11-5-7-12(18)8-6-11)20-22-17(23)27-10-14(24)19-21-16(25)13-4-3-9-26-13/h3-9H,2,10H2,1H3,(H,19,24)(H,21,25) |
| InChIKey | RJSGDVKEYXYVIF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|