C21H22ClN5O2S — CID 136902152
2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-hydroxyphenyl)propylideneamino]acetamide (PubChem CID 136902152) has the molecular formula C21H22ClN5O2S and a molecular weight of 443.96 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-hydroxyphenyl)propylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-hydroxyphenyl)propylideneamino]acetamide |
|---|---|
| PubChem CID | 136902152 |
| Molecular Formula | C21H22ClN5O2S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-hydroxyphenyl)propylideneamino]acetamide |
| SMILES | CC/C(=N/NC(=O)CSc1nnc(-c2ccc(Cl)cc2)n1CC)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H22ClN5O2S/c1-3-18(14-7-11-17(28)12-8-14)23-24-19(29)13-30-21-26-25-20(27(21)4-2)15-5-9-16(22)10-6-15/h5-12,28H,3-4,13H2,1-2H3,(H,24,29)/b23-18- |
| InChIKey | GLKUMDJTQACMGA-NKFKGCMQSA-N |
| XLogP | 4.35 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|