C27H27N5OS — CID 6372520
2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]acetamide (PubChem CID 6372520) has the molecular formula C27H27N5OS and a molecular weight of 469.61 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 6372520 |
| Molecular Formula | C27H27N5OS |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]acetamide |
| SMILES | CCn1c(SCC(=O)N/N=C(/C)c2ccc(-c3ccccc3)cc2)nnc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C27H27N5OS/c1-4-32-26(24-12-10-19(2)11-13-24)30-31-27(32)34-18-25(33)29-28-20(3)21-14-16-23(17-15-21)22-8-6-5-7-9-22/h5-17H,4,18H2,1-3H3,(H,29,33)/b28-20- |
| InChIKey | OYBCUQGIMVEKAE-RRAHZORUSA-N |
| XLogP | 5.57 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|