C21H22N6O3S — CID 6110284
2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]acetamide (PubChem CID 6110284) has the molecular formula C21H22N6O3S and a molecular weight of 438.51 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 6110284 |
| Molecular Formula | C21H22N6O3S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]acetamide |
| SMILES | CCn1c(SCC(=O)N/N=C(/C)c2cccc([N+](=O)[O-])c2)nnc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22N6O3S/c1-4-26-20(16-10-8-14(2)9-11-16)24-25-21(26)31-13-19(28)23-22-15(3)17-6-5-7-18(12-17)27(29)30/h5-12H,4,13H2,1-3H3,(H,23,28)/b22-15- |
| InChIKey | PZPBOPBANIQTSD-JCMHNJIXSA-N |
| XLogP | 3.81 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|