C20H19BrClN5OS — CID 4220440
N-[1-(3-bromophenyl)ethylideneamino]-2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4220440) has the molecular formula C20H19BrClN5OS and a molecular weight of 492.83 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)ethylideneamino]-2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[1-(3-bromophenyl)ethylideneamino]-2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4220440 |
| Molecular Formula | C20H19BrClN5OS |
| Molecular Weight | 492.83 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | N-[1-(3-bromophenyl)ethylideneamino]-2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)NN=C(C)c2cccc(Br)c2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19BrClN5OS/c1-3-27-19(14-7-9-17(22)10-8-14)25-26-20(27)29-12-18(28)24-23-13(2)15-5-4-6-16(21)11-15/h4-11H,3,12H2,1-2H3,(H,24,28) |
| InChIKey | WPMWRQKREYMENL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.83 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|