C24H27Cl2N5OS — CID 3786570
2-[[5-(4-tert-butylphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(3,4-dichlorophenyl)ethylideneamino]acetamide (PubChem CID 3786570) has the molecular formula C24H27Cl2N5OS and a molecular weight of 504.49 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(3,4-dichlorophenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(3,4-dichlorophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 3786570 |
| Molecular Formula | C24H27Cl2N5OS |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(3,4-dichlorophenyl)ethylideneamino]acetamide |
| SMILES | CCn1c(SCC(=O)NN=C(C)c2ccc(Cl)c(Cl)c2)nnc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H27Cl2N5OS/c1-6-31-22(16-7-10-18(11-8-16)24(3,4)5)29-30-23(31)33-14-21(32)28-27-15(2)17-9-12-19(25)20(26)13-17/h7-13H,6,14H2,1-5H3,(H,28,32) |
| InChIKey | YPWOOIUOFYQNRK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|