C24H17Cl4N5OS — CID 4505896
2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(3,4-dichlorophenyl)ethylideneamino]acetamide (PubChem CID 4505896) has the molecular formula C24H17Cl4N5OS and a molecular weight of 565.31 g/mol. Its IUPAC name is 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(3,4-dichlorophenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(3,4-dichlorophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 4505896 |
| Molecular Formula | C24H17Cl4N5OS |
| Molecular Weight | 565.31 g/mol |
| Exact Mass | 562.99 |
| IUPAC Name | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(3,4-dichlorophenyl)ethylideneamino]acetamide |
| SMILES | CC(=NNC(=O)CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H17Cl4N5OS/c1-14(16-4-11-20(27)21(28)12-16)29-30-22(34)13-35-24-32-31-23(15-2-5-17(25)6-3-15)33(24)19-9-7-18(26)8-10-19/h2-12H,13H2,1H3,(H,30,34) |
| InChIKey | DIRVTZDXEQRHLF-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.31 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|