C23H18Cl2N6OS — CID 3474716
N-[1-(4-chlorophenyl)ethylideneamino]-2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3474716) has the molecular formula C23H18Cl2N6OS and a molecular weight of 497.41 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethylideneamino]-2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[1-(4-chlorophenyl)ethylideneamino]-2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3474716 |
| Molecular Formula | C23H18Cl2N6OS |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethylideneamino]-2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC(=NNC(=O)CSc1nnc(-c2ccncc2)n1-c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18Cl2N6OS/c1-15(16-2-4-18(24)5-3-16)27-28-21(32)14-33-23-30-29-22(17-10-12-26-13-11-17)31(23)20-8-6-19(25)7-9-20/h2-13H,14H2,1H3,(H,28,32) |
| InChIKey | WWAUAHXCFPNDHR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|